About 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one
1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one (PubChem CID 71423218) has the molecular formula C14H16N2O3S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one.
Molecular Properties
| Compound Name | 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one |
| PubChem CID | 71423218 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one |
| SMILES | C=CCCC(=O)C(=[N+]=[N-])S(=O)(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C14H16N2O3S/c1-4-5-6-12(17)14(16-15)20(18,19)13-8-7-10(2)9-11(13)3/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | XXYSDKUSJMMCTC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one?
The IUPAC name of 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one (CID 71423218) is 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one.
What is the SMILES notation for 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one?
The canonical SMILES for 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one is C=CCCC(=O)C(=[N+]=[N-])S(=O)(=O)c1ccc(C)cc1C.
What is the InChIKey of 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one?
The InChIKey is XXYSDKUSJMMCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3S/c1-4-5-6-12(17)14(16-15)20(18,19)13-8-7-10(2)9-11(13)3/h4,7-9H,1,5-6H2,2-3H3.
What are the key properties of 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one?
1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one has a molecular weight of 292.36 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazo-1-(2,4-dimethylphenyl)sulfonylhex-5-en-2-one is sourced from PubChem (CID 71423218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).