C11H20O2S2 — CID 71423242
(4R)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane (PubChem CID 71423242) has the molecular formula C11H20O2S2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (4R)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane.
| Compound Name | (4R)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 71423242 |
| Molecular Formula | C11H20O2S2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (4R)-4-(1,3-dithian-2-ylmethyl)-2,2-dimethyl-1,3-dioxane |
| SMILES | CC1(C)OCC[C@H](CC2SCCCS2)O1 |
| InChI | InChI=1S/C11H20O2S2/c1-11(2)12-5-4-9(13-11)8-10-14-6-3-7-15-10/h9-10H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | IUWANOTXUMEQDL-SECBINFHSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |