About 1H-pyrrole-2,3,4-tricarboxylic acid
1H-pyrrole-2,3,4-tricarboxylic acid (PubChem CID 71423390) has the molecular formula C7H5NO6
and a molecular weight of 199.12 g/mol. Its IUPAC name is 1H-pyrrole-2,3,4-tricarboxylic acid.
Molecular Properties
| Compound Name | 1H-pyrrole-2,3,4-tricarboxylic acid |
| PubChem CID | 71423390 |
| Molecular Formula | C7H5NO6 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 1H-pyrrole-2,3,4-tricarboxylic acid |
| SMILES | O=C(O)c1c[nH]c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C7H5NO6/c9-5(10)2-1-8-4(7(13)14)3(2)6(11)12/h1,8H,(H,9,10)(H,11,12)(H,13,14) |
| InChIKey | IBLWXWNVAFCXCW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrrole-2,3,4-tricarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrole-2,3,4-tricarboxylic acid?
The IUPAC name of 1H-pyrrole-2,3,4-tricarboxylic acid (CID 71423390) is 1H-pyrrole-2,3,4-tricarboxylic acid.
What is the SMILES notation for 1H-pyrrole-2,3,4-tricarboxylic acid?
The canonical SMILES for 1H-pyrrole-2,3,4-tricarboxylic acid is O=C(O)c1c[nH]c(C(=O)O)c1C(=O)O.
What is the InChIKey of 1H-pyrrole-2,3,4-tricarboxylic acid?
The InChIKey is IBLWXWNVAFCXCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO6/c9-5(10)2-1-8-4(7(13)14)3(2)6(11)12/h1,8H,(H,9,10)(H,11,12)(H,13,14).
What are the key properties of 1H-pyrrole-2,3,4-tricarboxylic acid?
1H-pyrrole-2,3,4-tricarboxylic acid has a molecular weight of 199.12 g/mol, XLogP of 0.11, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrole-2,3,4-tricarboxylic acid is sourced from PubChem (CID 71423390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).