About 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one
4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one (PubChem CID 71423520) has the molecular formula C22H20O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one.
Molecular Properties
| Compound Name | 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one |
| PubChem CID | 71423520 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one |
| SMILES | Cc1cc(C)c(C#CCOCC(=O)C#Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H20O2/c1-17-14-18(2)22(19(3)15-17)10-7-13-24-16-21(23)12-11-20-8-5-4-6-9-20/h4-6,8-9,14-15H,13,16H2,1-3H3 |
| InChIKey | MGEYILCNRMARBB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one?
The IUPAC name of 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one (CID 71423520) is 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one.
What is the SMILES notation for 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one?
The canonical SMILES for 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one is Cc1cc(C)c(C#CCOCC(=O)C#Cc2ccccc2)c(C)c1.
What is the InChIKey of 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one?
The InChIKey is MGEYILCNRMARBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O2/c1-17-14-18(2)22(19(3)15-17)10-7-13-24-16-21(23)12-11-20-8-5-4-6-9-20/h4-6,8-9,14-15H,13,16H2,1-3H3.
What are the key properties of 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one?
4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one has a molecular weight of 316.40 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-[3-(2,4,6-trimethylphenyl)prop-2-ynoxy]but-3-yn-2-one is sourced from PubChem (CID 71423520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).