About 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one
2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one (PubChem CID 71423757) has the molecular formula C9H7Cl2NO2S
and a molecular weight of 264.13 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one |
| PubChem CID | 71423757 |
| Molecular Formula | C9H7Cl2NO2S |
| Molecular Weight | 264.13 g/mol |
| Exact Mass | 262.96 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Cl)c(Cl)c2)N1O |
| InChI | InChI=1S/C9H7Cl2NO2S/c10-6-2-1-5(3-7(6)11)9-12(14)8(13)4-15-9/h1-3,9,14H,4H2 |
| InChIKey | KIJXKIGUVNLDFI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.13 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one?
The IUPAC name of 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one (CID 71423757) is 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one is O=C1CSC(c2ccc(Cl)c(Cl)c2)N1O.
What is the InChIKey of 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one?
The InChIKey is KIJXKIGUVNLDFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO2S/c10-6-2-1-5(3-7(6)11)9-12(14)8(13)4-15-9/h1-3,9,14H,4H2.
What are the key properties of 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one?
2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one has a molecular weight of 264.13 g/mol, XLogP of 2.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-3-hydroxy-1,3-thiazolidin-4-one is sourced from PubChem (CID 71423757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).