About [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol
[4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol (PubChem CID 71424003) has the molecular formula C19H16Cl2N2O
and a molecular weight of 359.26 g/mol. Its IUPAC name is [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol |
| PubChem CID | 71424003 |
| Molecular Formula | C19H16Cl2N2O |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol |
| SMILES | OCc1ccc(-c2cncc(NCc3ccc(Cl)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O/c20-18-6-3-14(7-19(18)21)9-23-17-8-16(10-22-11-17)15-4-1-13(12-24)2-5-15/h1-8,10-11,23-24H,9,12H2 |
| InChIKey | IBLYXYSKBLCSNH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol?
The IUPAC name of [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol (CID 71424003) is [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol.
What is the SMILES notation for [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol?
The canonical SMILES for [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol is OCc1ccc(-c2cncc(NCc3ccc(Cl)c(Cl)c3)c2)cc1.
What is the InChIKey of [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol?
The InChIKey is IBLYXYSKBLCSNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N2O/c20-18-6-3-14(7-19(18)21)9-23-17-8-16(10-22-11-17)15-4-1-13(12-24)2-5-15/h1-8,10-11,23-24H,9,12H2.
What are the key properties of [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol?
[4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol has a molecular weight of 359.26 g/mol, XLogP of 5.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-[(3,4-dichlorophenyl)methylamino]-3-pyridinyl]phenyl]methanol is sourced from PubChem (CID 71424003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).