About 6,12-bis(triethylsilyloxy)tetracene-5,11-dione
6,12-bis(triethylsilyloxy)tetracene-5,11-dione (PubChem CID 71424831) has the molecular formula C30H38O4Si2
and a molecular weight of 518.80 g/mol. Its IUPAC name is 6,12-bis(triethylsilyloxy)tetracene-5,11-dione.
Molecular Properties
| Compound Name | 6,12-bis(triethylsilyloxy)tetracene-5,11-dione |
| PubChem CID | 71424831 |
| Molecular Formula | C30H38O4Si2 |
| Molecular Weight | 518.80 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 6,12-bis(triethylsilyloxy)tetracene-5,11-dione |
| SMILES | CC[Si](CC)(CC)OC1=C2C(=O)c3ccccc3C(O[Si](CC)(CC)CC)=C2C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H38O4Si2/c1-7-35(8-2,9-3)33-29-23-19-15-13-17-21(23)28(32)26-25(29)27(31)22-18-14-16-20-24(22)30(26)34-36(10-4,11-5)12-6/h13-20H,7-12H2,1-6H3 |
| InChIKey | MSCRCFJZMXRBFJ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 518.80 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6,12-bis(triethylsilyloxy)tetracene-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,12-bis(triethylsilyloxy)tetracene-5,11-dione?
The IUPAC name of 6,12-bis(triethylsilyloxy)tetracene-5,11-dione (CID 71424831) is 6,12-bis(triethylsilyloxy)tetracene-5,11-dione.
What is the SMILES notation for 6,12-bis(triethylsilyloxy)tetracene-5,11-dione?
The canonical SMILES for 6,12-bis(triethylsilyloxy)tetracene-5,11-dione is CC[Si](CC)(CC)OC1=C2C(=O)c3ccccc3C(O[Si](CC)(CC)CC)=C2C(=O)c2ccccc21.
What is the InChIKey of 6,12-bis(triethylsilyloxy)tetracene-5,11-dione?
The InChIKey is MSCRCFJZMXRBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H38O4Si2/c1-7-35(8-2,9-3)33-29-23-19-15-13-17-21(23)28(32)26-25(29)27(31)22-18-14-16-20-24(22)30(26)34-36(10-4,11-5)12-6/h13-20H,7-12H2,1-6H3.
What are the key properties of 6,12-bis(triethylsilyloxy)tetracene-5,11-dione?
6,12-bis(triethylsilyloxy)tetracene-5,11-dione has a molecular weight of 518.80 g/mol, XLogP of 8.25, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,12-bis(triethylsilyloxy)tetracene-5,11-dione is sourced from PubChem (CID 71424831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).