C7H6F5N5O3 — CID 71425083
2-(3-nitro-1,2,4-triazol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide (PubChem CID 71425083) has the molecular formula C7H6F5N5O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 2-(3-nitro-1,2,4-triazol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide.
| Compound Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
|---|---|
| PubChem CID | 71425083 |
| Molecular Formula | C7H6F5N5O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-(3-nitro-1,2,4-triazol-1-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
| SMILES | O=C(Cn1cnc([N+](=O)[O-])n1)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F5N5O3/c8-6(9,7(10,11)12)2-13-4(18)1-16-3-14-5(15-16)17(19)20/h3H,1-2H2,(H,13,18) |
| InChIKey | DIVUMADSSXZEPH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|