C10H10N2O2 — CID 71425586
(6S)-2-methyl-6-phenyl-4H-1,3,4-oxadiazin-5-one (PubChem CID 71425586) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (6S)-2-methyl-6-phenyl-4H-1,3,4-oxadiazin-5-one.
| Compound Name | (6S)-2-methyl-6-phenyl-4H-1,3,4-oxadiazin-5-one |
|---|---|
| PubChem CID | 71425586 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (6S)-2-methyl-6-phenyl-4H-1,3,4-oxadiazin-5-one |
| SMILES | CC1=NNC(=O)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H10N2O2/c1-7-11-12-10(13)9(14-7)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | FANKADAYLYXVMN-VIFPVBQESA-N |
| XLogP | 1.21 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |