C15H16N2S2 — CID 71425824
3,4-diphenyl-1,6,3,4-dithiadiazepane (PubChem CID 71425824) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 3,4-diphenyl-1,6,3,4-dithiadiazepane.
| Compound Name | 3,4-diphenyl-1,6,3,4-dithiadiazepane |
|---|---|
| PubChem CID | 71425824 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3,4-diphenyl-1,6,3,4-dithiadiazepane |
| SMILES | c1ccc(N2CSCSCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H16N2S2/c1-3-7-14(8-4-1)16-11-18-13-19-12-17(16)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | WTXXVVMMPVYNFR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |