C5H2F8O4 — CID 71425844
2-fluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid (PubChem CID 71425844) has the molecular formula C5H2F8O4 and a molecular weight of 278.05 g/mol. Its IUPAC name is 2-fluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid.
| Compound Name | 2-fluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 71425844 |
| Molecular Formula | C5H2F8O4 |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 2-fluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]acetic acid |
| SMILES | O=C(O)C(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C5H2F8O4/c6-1(2(14)15)16-3(7,8)4(9,10)17-5(11,12)13/h1H,(H,14,15) |
| InChIKey | GHVHGLNEHMMXAV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|