C5H2F8O3 — CID 71425845
2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetic acid (PubChem CID 71425845) has the molecular formula C5H2F8O3 and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetic acid.
| Compound Name | 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetic acid |
|---|---|
| PubChem CID | 71425845 |
| Molecular Formula | C5H2F8O3 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-fluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)acetic acid |
| SMILES | O=C(O)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H2F8O3/c6-1(2(14)15)16-5(12,13)3(7,8)4(9,10)11/h1H,(H,14,15) |
| InChIKey | SOPKUPKNOTUECV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|