About 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide
2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide (PubChem CID 71426525) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide |
| PubChem CID | 71426525 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1cnc(C(C)(C)C)s1 |
| InChI | InChI=1S/C11H18N2OS/c1-11(2,3)10-12-7-8(15-10)6-9(14)13(4)5/h7H,6H2,1-5H3 |
| InChIKey | YSFODAYWZYKBRM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide (CID 71426525) is 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide is CN(C)C(=O)Cc1cnc(C(C)(C)C)s1.
What is the InChIKey of 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide?
The InChIKey is YSFODAYWZYKBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-11(2,3)10-12-7-8(15-10)6-9(14)13(4)5/h7H,6H2,1-5H3.
What are the key properties of 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide?
2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide has a molecular weight of 226.34 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butyl-1,3-thiazol-5-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 71426525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).