About 4-cyclopropylidene-2,3-dihydro-1H-naphthalene
4-cyclopropylidene-2,3-dihydro-1H-naphthalene (PubChem CID 71426688) has the molecular formula C13H14
and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-cyclopropylidene-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 4-cyclopropylidene-2,3-dihydro-1H-naphthalene |
| PubChem CID | 71426688 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-cyclopropylidene-2,3-dihydro-1H-naphthalene |
| SMILES | c1ccc2c(c1)CCCC2=C1CC1 |
| InChI | InChI=1S/C13H14/c1-2-6-12-10(4-1)5-3-7-13(12)11-8-9-11/h1-2,4,6H,3,5,7-9H2 |
| InChIKey | XTMDIKNALSILQX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-cyclopropylidene-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropylidene-2,3-dihydro-1H-naphthalene?
The IUPAC name of 4-cyclopropylidene-2,3-dihydro-1H-naphthalene (CID 71426688) is 4-cyclopropylidene-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 4-cyclopropylidene-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 4-cyclopropylidene-2,3-dihydro-1H-naphthalene is c1ccc2c(c1)CCCC2=C1CC1.
What is the InChIKey of 4-cyclopropylidene-2,3-dihydro-1H-naphthalene?
The InChIKey is XTMDIKNALSILQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-2-6-12-10(4-1)5-3-7-13(12)11-8-9-11/h1-2,4,6H,3,5,7-9H2.
What are the key properties of 4-cyclopropylidene-2,3-dihydro-1H-naphthalene?
4-cyclopropylidene-2,3-dihydro-1H-naphthalene has a molecular weight of 170.26 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropylidene-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 71426688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).