About (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane
(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane (PubChem CID 71427059) has the molecular formula C21H18N2S2Sn
and a molecular weight of 481.23 g/mol. Its IUPAC name is (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane.
Molecular Properties
| Compound Name | (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane |
| PubChem CID | 71427059 |
| Molecular Formula | C21H18N2S2Sn |
| Molecular Weight | 481.23 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane |
| SMILES | Cc1nnc(S[Sn](c2ccccc2)(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/3C6H5.C3H4N2S2.Sn/c3*1-2-4-6-5-3-1;1-2-4-5-3(6)7-2;/h3*1-5H;1H3,(H,5,6);/q;;;;+1/p-1 |
| InChIKey | DCMVUCLJAMNSSV-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane?
The IUPAC name of (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane (CID 71427059) is (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane.
What is the SMILES notation for (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane?
The canonical SMILES for (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane is Cc1nnc(S[Sn](c2ccccc2)(c2ccccc2)c2ccccc2)s1.
What is the InChIKey of (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane?
The InChIKey is DCMVUCLJAMNSSV-UHFFFAOYSA-M. The full InChI is InChI=1S/3C6H5.C3H4N2S2.Sn/c3*1-2-4-6-5-3-1;1-2-4-5-3(6)7-2;/h3*1-5H;1H3,(H,5,6);/q;;;;+1/p-1.
What are the key properties of (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane?
(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane has a molecular weight of 481.23 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl-triphenylstannane is sourced from PubChem (CID 71427059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).