About 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan
2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan (PubChem CID 71427197) has the molecular formula C14H12BrNO3
and a molecular weight of 322.16 g/mol. Its IUPAC name is 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan.
Molecular Properties
| Compound Name | 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan |
| PubChem CID | 71427197 |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan |
| SMILES | Cc1cc(C)cc(-c2ccc(C=C(Br)[N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C14H12BrNO3/c1-9-5-10(2)7-11(6-9)13-4-3-12(19-13)8-14(15)16(17)18/h3-8H,1-2H3 |
| InChIKey | DATOWFLSXZEBEN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan?
The IUPAC name of 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan (CID 71427197) is 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan.
What is the SMILES notation for 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan?
The canonical SMILES for 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan is Cc1cc(C)cc(-c2ccc(C=C(Br)[N+](=O)[O-])o2)c1.
What is the InChIKey of 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan?
The InChIKey is DATOWFLSXZEBEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNO3/c1-9-5-10(2)7-11(6-9)13-4-3-12(19-13)8-14(15)16(17)18/h3-8H,1-2H3.
What are the key properties of 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan?
2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan has a molecular weight of 322.16 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-2-nitroethenyl)-5-(3,5-dimethylphenyl)furan is sourced from PubChem (CID 71427197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).