C72H88Si4 — CID 71427220
1,1,2,2,3,3,4,4-octakis(2,4,6-trimethylphenyl)tetrasiletane (PubChem CID 71427220) has the molecular formula C72H88Si4 and a molecular weight of 1065.84 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octakis(2,4,6-trimethylphenyl)tetrasiletane.
| Compound Name | 1,1,2,2,3,3,4,4-octakis(2,4,6-trimethylphenyl)tetrasiletane |
|---|---|
| PubChem CID | 71427220 |
| Molecular Formula | C72H88Si4 |
| Molecular Weight | 1065.84 g/mol |
| Exact Mass | 1064.60 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octakis(2,4,6-trimethylphenyl)tetrasiletane |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)[Si](c3c(C)cc(C)cc3C)(c3c(C)cc(C)cc3C)[Si](c3c(C)cc(C)cc3C)(c3c(C)cc(C)cc3C)[Si]2(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C72H88Si4/c1-41-25-49(9)65(50(10)26-41)73(66-51(11)27-42(2)28-52(66)12)74(67-53(13)29-43(3)30-54(67)14,68-55(15)31-44(4)32-56(68)16)76(71-61(21)37-47(7)38-62(71)22,72-63(23)39-48(8)40-64(72)24)75(73,69-57(17)33-45(5)34-58(69)18)70-59(19)35-46(6)36-60(70)20/h25-40H,1-24H3 |
| InChIKey | ZVFLVIQWPHFMFO-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.84 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|