About 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one
5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one (PubChem CID 71427230) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one |
| PubChem CID | 71427230 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one |
| SMILES | C#CCN1CC(=C)OC1=O |
| InChI | InChI=1S/C7H7NO2/c1-3-4-8-5-6(2)10-7(8)9/h1H,2,4-5H2 |
| InChIKey | VMOPWWPTMVRFNY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one?
The IUPAC name of 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one (CID 71427230) is 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one?
The canonical SMILES for 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one is C#CCN1CC(=C)OC1=O.
What is the InChIKey of 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one?
The InChIKey is VMOPWWPTMVRFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c1-3-4-8-5-6(2)10-7(8)9/h1H,2,4-5H2.
What are the key properties of 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one?
5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one has a molecular weight of 137.14 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-3-prop-2-ynyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 71427230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).