About 1-cyclohexyl-2,3-dimethylbut-3-en-1-one
1-cyclohexyl-2,3-dimethylbut-3-en-1-one (PubChem CID 71427376) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-dimethylbut-3-en-1-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,3-dimethylbut-3-en-1-one |
| PubChem CID | 71427376 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-cyclohexyl-2,3-dimethylbut-3-en-1-one |
| SMILES | C=C(C)C(C)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H20O/c1-9(2)10(3)12(13)11-7-5-4-6-8-11/h10-11H,1,4-8H2,2-3H3 |
| InChIKey | JRYBRAWHBUORCH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-2,3-dimethylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,3-dimethylbut-3-en-1-one?
The IUPAC name of 1-cyclohexyl-2,3-dimethylbut-3-en-1-one (CID 71427376) is 1-cyclohexyl-2,3-dimethylbut-3-en-1-one.
What is the SMILES notation for 1-cyclohexyl-2,3-dimethylbut-3-en-1-one?
The canonical SMILES for 1-cyclohexyl-2,3-dimethylbut-3-en-1-one is C=C(C)C(C)C(=O)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,3-dimethylbut-3-en-1-one?
The InChIKey is JRYBRAWHBUORCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-9(2)10(3)12(13)11-7-5-4-6-8-11/h10-11H,1,4-8H2,2-3H3.
What are the key properties of 1-cyclohexyl-2,3-dimethylbut-3-en-1-one?
1-cyclohexyl-2,3-dimethylbut-3-en-1-one has a molecular weight of 180.29 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,3-dimethylbut-3-en-1-one is sourced from PubChem (CID 71427376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).