About 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one
3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one (PubChem CID 71427723) has the molecular formula C23H17N3O2S
and a molecular weight of 399.48 g/mol. Its IUPAC name is 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one.
Molecular Properties
| Compound Name | 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one |
| PubChem CID | 71427723 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one |
| SMILES | CCOc1ccc2sc(-n3c(-c4ccccc4)nc4ccccc4c3=O)nc2c1 |
| InChI | InChI=1S/C23H17N3O2S/c1-2-28-16-12-13-20-19(14-16)25-23(29-20)26-21(15-8-4-3-5-9-15)24-18-11-7-6-10-17(18)22(26)27/h3-14H,2H2,1H3 |
| InChIKey | GCNOQTUUTPUANX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one?
The IUPAC name of 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one (CID 71427723) is 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one.
What is the SMILES notation for 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one?
The canonical SMILES for 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one is CCOc1ccc2sc(-n3c(-c4ccccc4)nc4ccccc4c3=O)nc2c1.
What is the InChIKey of 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one?
The InChIKey is GCNOQTUUTPUANX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2S/c1-2-28-16-12-13-20-19(14-16)25-23(29-20)26-21(15-8-4-3-5-9-15)24-18-11-7-6-10-17(18)22(26)27/h3-14H,2H2,1H3.
What are the key properties of 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one?
3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one has a molecular weight of 399.48 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethoxy-1,3-benzothiazol-2-yl)-2-phenylquinazolin-4-one is sourced from PubChem (CID 71427723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).