About 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one
4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one (PubChem CID 71428155) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one |
| PubChem CID | 71428155 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one |
| SMILES | CC(=C1C=CC(=O)CC1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H24O/c1-12(13-6-8-15(17)9-7-13)14-5-4-10-16(2,3)11-14/h6,8,14H,4-5,7,9-11H2,1-3H3 |
| InChIKey | WPYYMZIBFBEEEJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one?
The IUPAC name of 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one (CID 71428155) is 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one.
What is the SMILES notation for 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one?
The canonical SMILES for 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one is CC(=C1C=CC(=O)CC1)C1CCCC(C)(C)C1.
What is the InChIKey of 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one?
The InChIKey is WPYYMZIBFBEEEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O/c1-12(13-6-8-15(17)9-7-13)14-5-4-10-16(2,3)11-14/h6,8,14H,4-5,7,9-11H2,1-3H3.
What are the key properties of 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one?
4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one has a molecular weight of 232.37 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3,3-dimethylcyclohexyl)ethylidene]cyclohex-2-en-1-one is sourced from PubChem (CID 71428155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).