About (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one
(4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one (PubChem CID 71428897) has the molecular formula C14H16O5
and a molecular weight of 264.28 g/mol. Its IUPAC name is (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one.
Molecular Properties
| Compound Name | (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one |
| PubChem CID | 71428897 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one |
| SMILES | COc1ccc([C@@H]2OC(=O)C[C@H]2C(C)=O)cc1OC |
| InChI | InChI=1S/C14H16O5/c1-8(15)10-7-13(16)19-14(10)9-4-5-11(17-2)12(6-9)18-3/h4-6,10,14H,7H2,1-3H3/t10-,14-/m0/s1 |
| InChIKey | UGADVQQKXGFQTG-HZMBPMFUSA-N |
| XLogP | 1.90 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one?
The IUPAC name of (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one (CID 71428897) is (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one.
What is the SMILES notation for (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one?
The canonical SMILES for (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one is COc1ccc([C@@H]2OC(=O)C[C@H]2C(C)=O)cc1OC.
What is the InChIKey of (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one?
The InChIKey is UGADVQQKXGFQTG-HZMBPMFUSA-N. The full InChI is InChI=1S/C14H16O5/c1-8(15)10-7-13(16)19-14(10)9-4-5-11(17-2)12(6-9)18-3/h4-6,10,14H,7H2,1-3H3/t10-,14-/m0/s1.
What are the key properties of (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one?
(4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one has a molecular weight of 264.28 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4-acetyl-5-(3,4-dimethoxyphenyl)oxolan-2-one is sourced from PubChem (CID 71428897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).