About 1,3-bis(2,3-dihydroxypropyl)urea
1,3-bis(2,3-dihydroxypropyl)urea (PubChem CID 71428979) has the molecular formula C7H16N2O5
and a molecular weight of 208.21 g/mol. Its IUPAC name is 1,3-bis(2,3-dihydroxypropyl)urea.
Molecular Properties
| Compound Name | 1,3-bis(2,3-dihydroxypropyl)urea |
| PubChem CID | 71428979 |
| Molecular Formula | C7H16N2O5 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1,3-bis(2,3-dihydroxypropyl)urea |
| SMILES | O=C(NCC(O)CO)NCC(O)CO |
| InChI | InChI=1S/C7H16N2O5/c10-3-5(12)1-8-7(14)9-2-6(13)4-11/h5-6,10-13H,1-4H2,(H2,8,9,14) |
| InChIKey | XXRSBPNOKSLPGL-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-bis(2,3-dihydroxypropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,3-dihydroxypropyl)urea?
The IUPAC name of 1,3-bis(2,3-dihydroxypropyl)urea (CID 71428979) is 1,3-bis(2,3-dihydroxypropyl)urea.
What is the SMILES notation for 1,3-bis(2,3-dihydroxypropyl)urea?
The canonical SMILES for 1,3-bis(2,3-dihydroxypropyl)urea is O=C(NCC(O)CO)NCC(O)CO.
What is the InChIKey of 1,3-bis(2,3-dihydroxypropyl)urea?
The InChIKey is XXRSBPNOKSLPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O5/c10-3-5(12)1-8-7(14)9-2-6(13)4-11/h5-6,10-13H,1-4H2,(H2,8,9,14).
What are the key properties of 1,3-bis(2,3-dihydroxypropyl)urea?
1,3-bis(2,3-dihydroxypropyl)urea has a molecular weight of 208.21 g/mol, XLogP of -3.01, 6 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,3-dihydroxypropyl)urea is sourced from PubChem (CID 71428979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).