C24H40N2O6S2 — CID 71429109
1-hexyl-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium;methanesulfonate (PubChem CID 71429109) has the molecular formula C24H40N2O6S2 and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-hexyl-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium;methanesulfonate.
| Compound Name | 1-hexyl-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium;methanesulfonate |
|---|---|
| PubChem CID | 71429109 |
| Molecular Formula | C24H40N2O6S2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-hexyl-4-(1-hexylpyridin-1-ium-4-yl)pyridin-1-ium;methanesulfonate |
| SMILES | CCCCCC[n+]1ccc(-c2cc[n+](CCCCCC)cc2)cc1.CS(=O)(=O)[O-].CS(=O)(=O)[O-] |
| InChI | InChI=1S/C22H34N2.2CH4O3S/c1-3-5-7-9-15-23-17-11-21(12-18-23)22-13-19-24(20-14-22)16-10-8-6-4-2;2*1-5(2,3)4/h11-14,17-20H,3-10,15-16H2,1-2H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
| InChIKey | JHGOROSHSDVZTJ-UHFFFAOYSA-L |
| XLogP | 3.41 |
| TPSA | 122.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|