C10H12F8S — CID 71429344
1-butylsulfanyl-3,4,4,5,5,6,6,6-octafluorohex-2-ene (PubChem CID 71429344) has the molecular formula C10H12F8S and a molecular weight of 316.26 g/mol. Its IUPAC name is 1-butylsulfanyl-3,4,4,5,5,6,6,6-octafluorohex-2-ene.
| Compound Name | 1-butylsulfanyl-3,4,4,5,5,6,6,6-octafluorohex-2-ene |
|---|---|
| PubChem CID | 71429344 |
| Molecular Formula | C10H12F8S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 1-butylsulfanyl-3,4,4,5,5,6,6,6-octafluorohex-2-ene |
| SMILES | CCCCSCC=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F8S/c1-2-3-5-19-6-4-7(11)8(12,13)9(14,15)10(16,17)18/h4H,2-3,5-6H2,1H3 |
| InChIKey | HREALCQLDPHGIF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|