C9H8F8 — CID 71429349
5,6,6,7,7,8,8,8-octafluoro-2-methylocta-2,4-diene (PubChem CID 71429349) has the molecular formula C9H8F8 and a molecular weight of 268.15 g/mol. Its IUPAC name is 5,6,6,7,7,8,8,8-octafluoro-2-methylocta-2,4-diene.
| Compound Name | 5,6,6,7,7,8,8,8-octafluoro-2-methylocta-2,4-diene |
|---|---|
| PubChem CID | 71429349 |
| Molecular Formula | C9H8F8 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5,6,6,7,7,8,8,8-octafluoro-2-methylocta-2,4-diene |
| SMILES | CC(C)=CC=C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F8/c1-5(2)3-4-6(10)7(11,12)8(13,14)9(15,16)17/h3-4H,1-2H3 |
| InChIKey | ZSBHSCZBWXUBAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|