C16H20N10 — CID 71429474
N,N'-dimethyl-N,N'-bis(9-methylpurin-6-yl)ethane-1,2-diamine (PubChem CID 71429474) has the molecular formula C16H20N10 and a molecular weight of 352.41 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(9-methylpurin-6-yl)ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis(9-methylpurin-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71429474 |
| Molecular Formula | C16H20N10 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(9-methylpurin-6-yl)ethane-1,2-diamine |
| SMILES | CN(CCN(C)c1ncnc2c1ncn2C)c1ncnc2c1ncn2C |
| InChI | InChI=1S/C16H20N10/c1-23(13-11-15(19-7-17-13)25(3)9-21-11)5-6-24(2)14-12-16(20-8-18-14)26(4)10-22-12/h7-10H,5-6H2,1-4H3 |
| InChIKey | PSZIZQKIXKBLCK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |