C11H21ClN2O4 — CID 71429569
4-cyclohexyl-1,2-dimethyl-1,3-dihydropyrazol-1-ium perchlorate (PubChem CID 71429569) has the molecular formula C11H21ClN2O4 and a molecular weight of 280.75 g/mol. Its IUPAC name is 4-cyclohexyl-1,2-dimethyl-1,3-dihydropyrazol-1-ium perchlorate.
| Compound Name | 4-cyclohexyl-1,2-dimethyl-1,3-dihydropyrazol-1-ium perchlorate |
|---|---|
| PubChem CID | 71429569 |
| Molecular Formula | C11H21ClN2O4 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-cyclohexyl-1,2-dimethyl-1,3-dihydropyrazol-1-ium perchlorate |
| SMILES | CN1CC(C2CCCCC2)=C[NH+]1C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H20N2.ClHO4/c1-12-8-11(9-13(12)2)10-6-4-3-5-7-10;2-1(3,4)5/h8,10H,3-7,9H2,1-2H3;(H,2,3,4,5) |
| InChIKey | DNFWSOJAQHTBOG-UHFFFAOYSA-N |
| XLogP | -3.93 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |