C21H19FN3O6S- — CID 7142959
2-[2-[(4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetate (PubChem CID 7142959) has the molecular formula C21H19FN3O6S- and a molecular weight of 460.46 g/mol. Its IUPAC name is 2-[2-[(4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetate.
| Compound Name | 2-[2-[(4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetate |
|---|---|
| PubChem CID | 7142959 |
| Molecular Formula | C21H19FN3O6S- |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[2-[(4aS,7aR)-3-(3-fluorophenyl)-2,4-dioxo-1-(thiophen-2-ylmethyl)-4a,6,7,7a-tetrahydropyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetate |
| SMILES | O=C([O-])COCC(=O)N1CC[C@@H]2[C@H]1C(=O)N(c1cccc(F)c1)C(=O)N2Cc1cccs1 |
| InChI | InChI=1S/C21H20FN3O6S/c22-13-3-1-4-14(9-13)25-20(29)19-16(24(21(25)30)10-15-5-2-8-32-15)6-7-23(19)17(26)11-31-12-18(27)28/h1-5,8-9,16,19H,6-7,10-12H2,(H,27,28)/p-1/t16-,19+/m1/s1 |
| InChIKey | MPJGNNOAFVGFOW-APWZRJJASA-M |
| XLogP | 0.59 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |