C15H13ClN2O3 — CID 71429785
2-methoxy-5-(pyridin-3-ylmethylcarbamoyl)benzoyl chloride (PubChem CID 71429785) has the molecular formula C15H13ClN2O3 and a molecular weight of 304.73 g/mol. Its IUPAC name is 2-methoxy-5-(pyridin-3-ylmethylcarbamoyl)benzoyl chloride.
| Compound Name | 2-methoxy-5-(pyridin-3-ylmethylcarbamoyl)benzoyl chloride |
|---|---|
| PubChem CID | 71429785 |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.73 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-methoxy-5-(pyridin-3-ylmethylcarbamoyl)benzoyl chloride |
| SMILES | COc1ccc(C(=O)NCc2cccnc2)cc1C(=O)Cl |
| InChI | InChI=1S/C15H13ClN2O3/c1-21-13-5-4-11(7-12(13)14(16)19)15(20)18-9-10-3-2-6-17-8-10/h2-8H,9H2,1H3,(H,18,20) |
| InChIKey | IQCXEZLYWKVHSA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.73 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|