C14H16O4 — CID 71429934
6,7-diethoxy-5,6-dihydronaphthalene-1,4-dione (PubChem CID 71429934) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 6,7-diethoxy-5,6-dihydronaphthalene-1,4-dione.
| Compound Name | 6,7-diethoxy-5,6-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 71429934 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 6,7-diethoxy-5,6-dihydronaphthalene-1,4-dione |
| SMILES | CCOC1=CC2=C(CC1OCC)C(=O)C=CC2=O |
| InChI | InChI=1S/C14H16O4/c1-3-17-13-7-9-10(8-14(13)18-4-2)12(16)6-5-11(9)15/h5-7,14H,3-4,8H2,1-2H3 |
| InChIKey | XTDOLYGHAJXBCI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|