About 1-methylquinolin-1-ium-8-ol;chloride;hydrate
1-methylquinolin-1-ium-8-ol;chloride;hydrate (PubChem CID 71430086) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is 1-methylquinolin-1-ium-8-ol;chloride;hydrate.
Molecular Properties
| Compound Name | 1-methylquinolin-1-ium-8-ol;chloride;hydrate |
| PubChem CID | 71430086 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1-methylquinolin-1-ium-8-ol;chloride;hydrate |
| SMILES | C[n+]1cccc2cccc(O)c21.O.[Cl-] |
| InChI | InChI=1S/C10H9NO.ClH.H2O/c1-11-7-3-5-8-4-2-6-9(12)10(8)11;;/h2-7H,1H3;1H;1H2 |
| InChIKey | AIFNQWYTNWWMAW-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methylquinolin-1-ium-8-ol;chloride;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylquinolin-1-ium-8-ol;chloride;hydrate?
The IUPAC name of 1-methylquinolin-1-ium-8-ol;chloride;hydrate (CID 71430086) is 1-methylquinolin-1-ium-8-ol;chloride;hydrate.
What is the SMILES notation for 1-methylquinolin-1-ium-8-ol;chloride;hydrate?
The canonical SMILES for 1-methylquinolin-1-ium-8-ol;chloride;hydrate is C[n+]1cccc2cccc(O)c21.O.[Cl-].
What is the InChIKey of 1-methylquinolin-1-ium-8-ol;chloride;hydrate?
The InChIKey is AIFNQWYTNWWMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.ClH.H2O/c1-11-7-3-5-8-4-2-6-9(12)10(8)11;;/h2-7H,1H3;1H;1H2.
What are the key properties of 1-methylquinolin-1-ium-8-ol;chloride;hydrate?
1-methylquinolin-1-ium-8-ol;chloride;hydrate has a molecular weight of 213.66 g/mol, XLogP of -2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylquinolin-1-ium-8-ol;chloride;hydrate is sourced from PubChem (CID 71430086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).