About 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile
3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile (PubChem CID 71430585) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile |
| PubChem CID | 71430585 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile |
| SMILES | CC1(C)CC(=O)C=C(CNCCC#N)C1 |
| InChI | InChI=1S/C12H18N2O/c1-12(2)7-10(6-11(15)8-12)9-14-5-3-4-13/h6,14H,3,5,7-9H2,1-2H3 |
| InChIKey | KYFQZQDCHZMCIJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile?
The IUPAC name of 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile (CID 71430585) is 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile.
What is the SMILES notation for 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile?
The canonical SMILES for 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile is CC1(C)CC(=O)C=C(CNCCC#N)C1.
What is the InChIKey of 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile?
The InChIKey is KYFQZQDCHZMCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-12(2)7-10(6-11(15)8-12)9-14-5-3-4-13/h6,14H,3,5,7-9H2,1-2H3.
What are the key properties of 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile?
3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile has a molecular weight of 206.29 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5,5-dimethyl-3-oxocyclohexen-1-yl)methylamino]propanenitrile is sourced from PubChem (CID 71430585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).