About spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane]
spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] (PubChem CID 71430725) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane].
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] |
| PubChem CID | 71430725 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] |
| SMILES | C1COC2(CC3CNCC32)O1 |
| InChI | InChI=1S/C8H13NO2/c1-2-11-8(10-1)3-6-4-9-5-7(6)8/h6-7,9H,1-5H2 |
| InChIKey | MKOVFRZQXCZRDQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane]?
The IUPAC name of spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] (CID 71430725) is spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane].
What is the SMILES notation for spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane]?
The canonical SMILES for spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] is C1COC2(CC3CNCC32)O1.
What is the InChIKey of spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane]?
The InChIKey is MKOVFRZQXCZRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-11-8(10-1)3-6-4-9-5-7(6)8/h6-7,9H,1-5H2.
What are the key properties of spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane]?
spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] has a molecular weight of 155.20 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,6'-3-azabicyclo[3.2.0]heptane] is sourced from PubChem (CID 71430725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).