C14H18N2O6S2 — CID 71430802
5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonic acid (PubChem CID 71430802) has the molecular formula C14H18N2O6S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonic acid.
| Compound Name | 5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonic acid |
|---|---|
| PubChem CID | 71430802 |
| Molecular Formula | C14H18N2O6S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 5,5-diamino-2-(2-phenylethenyl)cyclohex-3-ene-1,1-disulfonic acid |
| SMILES | NC1(N)C=CC(C=Cc2ccccc2)C(S(=O)(=O)O)(S(=O)(=O)O)C1 |
| InChI | InChI=1S/C14H18N2O6S2/c15-13(16)9-8-12(7-6-11-4-2-1-3-5-11)14(10-13,23(17,18)19)24(20,21)22/h1-9,12H,10,15-16H2,(H,17,18,19)(H,20,21,22) |
| InChIKey | VERUFXOALATMPS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|