About acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate
acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate (PubChem CID 71431183) has the molecular formula C14H16N2O5
and a molecular weight of 292.29 g/mol. Its IUPAC name is acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate.
Molecular Properties
| Compound Name | acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate |
| PubChem CID | 71431183 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate |
| SMILES | CC(=O)O.CC(=O)Oc1ccccn1.O=c1cccc[nH]1 |
| InChI | InChI=1S/C7H7NO2.C5H5NO.C2H4O2/c1-6(9)10-7-4-2-3-5-8-7;7-5-3-1-2-4-6-5;1-2(3)4/h2-5H,1H3;1-4H,(H,6,7);1H3,(H,3,4) |
| InChIKey | RNNAPVAFHDOMPS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate?
The IUPAC name of acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate (CID 71431183) is acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate.
What is the SMILES notation for acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate?
The canonical SMILES for acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate is CC(=O)O.CC(=O)Oc1ccccn1.O=c1cccc[nH]1.
What is the InChIKey of acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate?
The InChIKey is RNNAPVAFHDOMPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C5H5NO.C2H4O2/c1-6(9)10-7-4-2-3-5-8-7;7-5-3-1-2-4-6-5;1-2(3)4/h2-5H,1H3;1-4H,(H,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate?
acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate has a molecular weight of 292.29 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1H-pyridin-2-one;pyridin-2-yl acetate is sourced from PubChem (CID 71431183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).