About 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride
2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride (PubChem CID 71431300) has the molecular formula C7H10ClN3O3
and a molecular weight of 219.63 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride |
| PubChem CID | 71431300 |
| Molecular Formula | C7H10ClN3O3 |
| Molecular Weight | 219.63 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride |
| SMILES | CC(C(=O)NN)N1C(=O)C=CC1=O.Cl |
| InChI | InChI=1S/C7H9N3O3.ClH/c1-4(7(13)9-8)10-5(11)2-3-6(10)12;/h2-4H,8H2,1H3,(H,9,13);1H |
| InChIKey | GTRLFYMAARVXCX-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.63 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride (CID 71431300) is 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride is CC(C(=O)NN)N1C(=O)C=CC1=O.Cl.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride?
The InChIKey is GTRLFYMAARVXCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3.ClH/c1-4(7(13)9-8)10-5(11)2-3-6(10)12;/h2-4H,8H2,1H3,(H,9,13);1H.
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride?
2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride has a molecular weight of 219.63 g/mol, XLogP of -1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)propanehydrazide;hydrochloride is sourced from PubChem (CID 71431300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).