C36H40Cl2N6O8 — CID 71431363
2-[[4-[2-[dimethyl-[(4-nitrophenyl)methyl]azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl-dimethyl-[(4-nitrophenyl)methyl]azanium dichloride (PubChem CID 71431363) has the molecular formula C36H40Cl2N6O8 and a molecular weight of 755.66 g/mol. Its IUPAC name is 2-[[4-[2-[dimethyl-[(4-nitrophenyl)methyl]azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl-dimethyl-[(4-nitrophenyl)methyl]azanium dichloride.
| Compound Name | 2-[[4-[2-[dimethyl-[(4-nitrophenyl)methyl]azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl-dimethyl-[(4-nitrophenyl)methyl]azanium dichloride |
|---|---|
| PubChem CID | 71431363 |
| Molecular Formula | C36H40Cl2N6O8 |
| Molecular Weight | 755.66 g/mol |
| Exact Mass | 754.23 |
| IUPAC Name | 2-[[4-[2-[dimethyl-[(4-nitrophenyl)methyl]azaniumyl]ethylamino]-5,8-dihydroxy-9,10-dioxoanthracen-1-yl]amino]ethyl-dimethyl-[(4-nitrophenyl)methyl]azanium dichloride |
| SMILES | C[N+](C)(CCNc1ccc(NCC[N+](C)(C)Cc2ccc([N+](=O)[O-])cc2)c2c1C(=O)c1c(O)ccc(O)c1C2=O)Cc1ccc([N+](=O)[O-])cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C36H38N6O8.2ClH/c1-41(2,21-23-5-9-25(10-6-23)39(47)48)19-17-37-27-13-14-28(32-31(27)35(45)33-29(43)15-16-30(44)34(33)36(32)46)38-18-20-42(3,4)22-24-7-11-26(12-8-24)40(49)50;;/h5-16H,17-22H2,1-4H3,(H2-2,37,38,43,44,45,46);2*1H |
| InChIKey | JSZMUIARVRYHPU-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 184.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.66 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|