About 1-(5-bromothiophen-2-yl)ethyl propanimidate
1-(5-bromothiophen-2-yl)ethyl propanimidate (PubChem CID 71431405) has the molecular formula C9H12BrNOS
and a molecular weight of 262.17 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)ethyl propanimidate.
Molecular Properties
| Compound Name | 1-(5-bromothiophen-2-yl)ethyl propanimidate |
| PubChem CID | 71431405 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)ethyl propanimidate |
| SMILES | [H]/N=C(\CC)OC(C)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNOS/c1-3-9(11)12-6(2)7-4-5-8(10)13-7/h4-6,11H,3H2,1-2H3/b11-9+ |
| InChIKey | BQBKOPBABVIBCV-PKNBQFBNSA-N |
| XLogP | 3.98 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-bromothiophen-2-yl)ethyl propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromothiophen-2-yl)ethyl propanimidate?
The IUPAC name of 1-(5-bromothiophen-2-yl)ethyl propanimidate (CID 71431405) is 1-(5-bromothiophen-2-yl)ethyl propanimidate.
What is the SMILES notation for 1-(5-bromothiophen-2-yl)ethyl propanimidate?
The canonical SMILES for 1-(5-bromothiophen-2-yl)ethyl propanimidate is [H]/N=C(\CC)OC(C)c1ccc(Br)s1.
What is the InChIKey of 1-(5-bromothiophen-2-yl)ethyl propanimidate?
The InChIKey is BQBKOPBABVIBCV-PKNBQFBNSA-N. The full InChI is InChI=1S/C9H12BrNOS/c1-3-9(11)12-6(2)7-4-5-8(10)13-7/h4-6,11H,3H2,1-2H3/b11-9+.
What are the key properties of 1-(5-bromothiophen-2-yl)ethyl propanimidate?
1-(5-bromothiophen-2-yl)ethyl propanimidate has a molecular weight of 262.17 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromothiophen-2-yl)ethyl propanimidate is sourced from PubChem (CID 71431405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).