C13H16N4O3 — CID 71431628
2-methoxyethyl-[(4-phenyltriazol-1-yl)methyl]carbamic acid (PubChem CID 71431628) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-methoxyethyl-[(4-phenyltriazol-1-yl)methyl]carbamic acid.
| Compound Name | 2-methoxyethyl-[(4-phenyltriazol-1-yl)methyl]carbamic acid |
|---|---|
| PubChem CID | 71431628 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-methoxyethyl-[(4-phenyltriazol-1-yl)methyl]carbamic acid |
| SMILES | COCCN(Cn1cc(-c2ccccc2)nn1)C(=O)O |
| InChI | InChI=1S/C13H16N4O3/c1-20-8-7-16(13(18)19)10-17-9-12(14-15-17)11-5-3-2-4-6-11/h2-6,9H,7-8,10H2,1H3,(H,18,19) |
| InChIKey | FRWCQKAVMZOQTK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |