About 4-methylbenzenesulfonate;morpholin-4-ium
4-methylbenzenesulfonate;morpholin-4-ium (PubChem CID 71432021) has the molecular formula C11H17NO4S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;morpholin-4-ium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;morpholin-4-ium |
| PubChem CID | 71432021 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 4-methylbenzenesulfonate;morpholin-4-ium |
| SMILES | C1COCC[NH2+]1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C4H9NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-6-4-2-5-1/h2-5H,1H3,(H,8,9,10);5H,1-4H2 |
| InChIKey | LYWVNPSVLAFTFX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;morpholin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;morpholin-4-ium?
The IUPAC name of 4-methylbenzenesulfonate;morpholin-4-ium (CID 71432021) is 4-methylbenzenesulfonate;morpholin-4-ium.
What is the SMILES notation for 4-methylbenzenesulfonate;morpholin-4-ium?
The canonical SMILES for 4-methylbenzenesulfonate;morpholin-4-ium is C1COCC[NH2+]1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;morpholin-4-ium?
The InChIKey is LYWVNPSVLAFTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C4H9NO/c1-6-2-4-7(5-3-6)11(8,9)10;1-3-6-4-2-5-1/h2-5H,1H3,(H,8,9,10);5H,1-4H2.
What are the key properties of 4-methylbenzenesulfonate;morpholin-4-ium?
4-methylbenzenesulfonate;morpholin-4-ium has a molecular weight of 259.33 g/mol, XLogP of -0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;morpholin-4-ium is sourced from PubChem (CID 71432021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).