About N-benzylpyridin-3-amine;dihydrochloride
N-benzylpyridin-3-amine;dihydrochloride (PubChem CID 71432393) has the molecular formula C12H14Cl2N2
and a molecular weight of 257.16 g/mol. Its IUPAC name is N-benzylpyridin-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-benzylpyridin-3-amine;dihydrochloride |
| PubChem CID | 71432393 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-benzylpyridin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CNc2cccnc2)cc1 |
| InChI | InChI=1S/C12H12N2.2ClH/c1-2-5-11(6-3-1)9-14-12-7-4-8-13-10-12;;/h1-8,10,14H,9H2;2*1H |
| InChIKey | SZZRNRHOFYABKA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzylpyridin-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylpyridin-3-amine;dihydrochloride?
The IUPAC name of N-benzylpyridin-3-amine;dihydrochloride (CID 71432393) is N-benzylpyridin-3-amine;dihydrochloride.
What is the SMILES notation for N-benzylpyridin-3-amine;dihydrochloride?
The canonical SMILES for N-benzylpyridin-3-amine;dihydrochloride is Cl.Cl.c1ccc(CNc2cccnc2)cc1.
What is the InChIKey of N-benzylpyridin-3-amine;dihydrochloride?
The InChIKey is SZZRNRHOFYABKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.2ClH/c1-2-5-11(6-3-1)9-14-12-7-4-8-13-10-12;;/h1-8,10,14H,9H2;2*1H.
What are the key properties of N-benzylpyridin-3-amine;dihydrochloride?
N-benzylpyridin-3-amine;dihydrochloride has a molecular weight of 257.16 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylpyridin-3-amine;dihydrochloride is sourced from PubChem (CID 71432393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).