C19H12F10N2O2 — CID 71433851
N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]pentane-1,5-diimine (PubChem CID 71433851) has the molecular formula C19H12F10N2O2 and a molecular weight of 490.30 g/mol. Its IUPAC name is N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]pentane-1,5-diimine.
| Compound Name | N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]pentane-1,5-diimine |
|---|---|
| PubChem CID | 71433851 |
| Molecular Formula | C19H12F10N2O2 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | N,N'-bis[(2,3,4,5,6-pentafluorophenyl)methoxy]pentane-1,5-diimine |
| SMILES | Fc1c(F)c(F)c(CON=CCCCC=NOCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C19H12F10N2O2/c20-10-8(11(21)15(25)18(28)14(10)24)6-32-30-4-2-1-3-5-31-33-7-9-12(22)16(26)19(29)17(27)13(9)23/h4-5H,1-3,6-7H2 |
| InChIKey | YAGVMVPKFZBARN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|