C21H26ClN — CID 71434334
N-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine;hydrochloride (PubChem CID 71434334) has the molecular formula C21H26ClN and a molecular weight of 334.94 g/mol. Its IUPAC name is N-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine;hydrochloride.
| Compound Name | N-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine;hydrochloride |
|---|---|
| PubChem CID | 71434334 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 334.94 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | N-[(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methyl]-N,6,6-trimethylhept-2-en-4-yn-1-amine;hydrochloride |
| SMILES | Cl.[2H]c1c([2H])c([2H])c2c(CN(C)CC=CC#CC(C)(C)C)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/i6D,7D,10D,11D,12D,13D,14D; |
| InChIKey | BWMISRWJRUSYEX-JOUZVVBCSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.94 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|