About 4-ethynyl-4,5-dimethyl-1,3-dioxane
4-ethynyl-4,5-dimethyl-1,3-dioxane (PubChem CID 71434446) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 4-ethynyl-4,5-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-ethynyl-4,5-dimethyl-1,3-dioxane |
| PubChem CID | 71434446 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 4-ethynyl-4,5-dimethyl-1,3-dioxane |
| SMILES | C#CC1(C)OCOCC1C |
| InChI | InChI=1S/C8H12O2/c1-4-8(3)7(2)5-9-6-10-8/h1,7H,5-6H2,2-3H3 |
| InChIKey | JFEITSCXRDAUDA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethynyl-4,5-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethynyl-4,5-dimethyl-1,3-dioxane?
The IUPAC name of 4-ethynyl-4,5-dimethyl-1,3-dioxane (CID 71434446) is 4-ethynyl-4,5-dimethyl-1,3-dioxane.
What is the SMILES notation for 4-ethynyl-4,5-dimethyl-1,3-dioxane?
The canonical SMILES for 4-ethynyl-4,5-dimethyl-1,3-dioxane is C#CC1(C)OCOCC1C.
What is the InChIKey of 4-ethynyl-4,5-dimethyl-1,3-dioxane?
The InChIKey is JFEITSCXRDAUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-4-8(3)7(2)5-9-6-10-8/h1,7H,5-6H2,2-3H3.
What are the key properties of 4-ethynyl-4,5-dimethyl-1,3-dioxane?
4-ethynyl-4,5-dimethyl-1,3-dioxane has a molecular weight of 140.18 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethynyl-4,5-dimethyl-1,3-dioxane is sourced from PubChem (CID 71434446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).