About 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one
4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one (PubChem CID 71434733) has the molecular formula C4H4ClFO3
and a molecular weight of 154.52 g/mol. Its IUPAC name is 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one |
| PubChem CID | 71434733 |
| Molecular Formula | C4H4ClFO3 |
| Molecular Weight | 154.52 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1(Cl)OC(=O)OC1F |
| InChI | InChI=1S/C4H4ClFO3/c1-4(5)2(6)8-3(7)9-4/h2H,1H3 |
| InChIKey | OXXIZWHRUMPOCP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one?
The IUPAC name of 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one (CID 71434733) is 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one.
What is the SMILES notation for 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one?
The canonical SMILES for 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one is CC1(Cl)OC(=O)OC1F.
What is the InChIKey of 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one?
The InChIKey is OXXIZWHRUMPOCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClFO3/c1-4(5)2(6)8-3(7)9-4/h2H,1H3.
What are the key properties of 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one?
4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one has a molecular weight of 154.52 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-fluoro-4-methyl-1,3-dioxolan-2-one is sourced from PubChem (CID 71434733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).