C14H16N2O5 — CID 71434928
2-acetamido-4-(2-acetamidophenyl)-4-oxobutanoic acid (PubChem CID 71434928) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-acetamido-4-(2-acetamidophenyl)-4-oxobutanoic acid.
| Compound Name | 2-acetamido-4-(2-acetamidophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71434928 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-acetamido-4-(2-acetamidophenyl)-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1ccccc1C(=O)CC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H16N2O5/c1-8(17)15-11-6-4-3-5-10(11)13(19)7-12(14(20)21)16-9(2)18/h3-6,12H,7H2,1-2H3,(H,15,17)(H,16,18)(H,20,21) |
| InChIKey | ICDIWXSXHWPWBS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |