About magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)
magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) (PubChem CID 71434987) has the molecular formula C18H18MgO8
and a molecular weight of 386.64 g/mol. Its IUPAC name is magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate).
Molecular Properties
| Compound Name | magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) |
| PubChem CID | 71434987 |
| Molecular Formula | C18H18MgO8 |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) |
| SMILES | CC(=O)C1(O)C=CC=CC1C(=O)[O-].CC(=O)C1(O)C=CC=CC1C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C9H10O4.Mg/c2*1-6(10)9(13)5-3-2-4-7(9)8(11)12;/h2*2-5,7,13H,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | WYAZBEWRLVJXRE-UHFFFAOYSA-L |
| XLogP | -2.78 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The IUPAC name of magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) (CID 71434987) is magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate).
What is the SMILES notation for magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The canonical SMILES for magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) is CC(=O)C1(O)C=CC=CC1C(=O)[O-].CC(=O)C1(O)C=CC=CC1C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
The InChIKey is WYAZBEWRLVJXRE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H10O4.Mg/c2*1-6(10)9(13)5-3-2-4-7(9)8(11)12;/h2*2-5,7,13H,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate)?
magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) has a molecular weight of 386.64 g/mol, XLogP of -2.78, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylate) is sourced from PubChem (CID 71434987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).