About 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane
3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane (PubChem CID 71435478) has the molecular formula C8H15O5P-2
and a molecular weight of 222.18 g/mol. Its IUPAC name is 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane.
Molecular Properties
| Compound Name | 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane |
| PubChem CID | 71435478 |
| Molecular Formula | C8H15O5P-2 |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane |
| SMILES | CCC(CC)(C1OCCO1)P(=O)([O-])[O-] |
| InChI | InChI=1S/C8H17O5P/c1-3-8(4-2,14(9,10)11)7-12-5-6-13-7/h7H,3-6H2,1-2H3,(H2,9,10,11)/p-2 |
| InChIKey | CMDZHPXZVSUULA-UHFFFAOYSA-L |
| XLogP | -0.17 |
| TPSA | 81.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane?
The IUPAC name of 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane (CID 71435478) is 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane.
What is the SMILES notation for 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane?
The canonical SMILES for 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane is CCC(CC)(C1OCCO1)P(=O)([O-])[O-].
What is the InChIKey of 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane?
The InChIKey is CMDZHPXZVSUULA-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H17O5P/c1-3-8(4-2,14(9,10)11)7-12-5-6-13-7/h7H,3-6H2,1-2H3,(H2,9,10,11)/p-2.
What are the key properties of 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane?
3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane has a molecular weight of 222.18 g/mol, XLogP of -0.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxolan-2-yl)pentan-3-yl-dioxido-oxo-λ5-phosphane is sourced from PubChem (CID 71435478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).