About 4-chloro-2,5-dimethylhexan-3-one
4-chloro-2,5-dimethylhexan-3-one (PubChem CID 71435660) has the molecular formula C8H15ClO
and a molecular weight of 162.66 g/mol. Its IUPAC name is 4-chloro-2,5-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 4-chloro-2,5-dimethylhexan-3-one |
| PubChem CID | 71435660 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-chloro-2,5-dimethylhexan-3-one |
| SMILES | CC(C)C(=O)C(Cl)C(C)C |
| InChI | InChI=1S/C8H15ClO/c1-5(2)7(9)8(10)6(3)4/h5-7H,1-4H3 |
| InChIKey | FPCHVATUIQGKPZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,5-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,5-dimethylhexan-3-one?
The IUPAC name of 4-chloro-2,5-dimethylhexan-3-one (CID 71435660) is 4-chloro-2,5-dimethylhexan-3-one.
What is the SMILES notation for 4-chloro-2,5-dimethylhexan-3-one?
The canonical SMILES for 4-chloro-2,5-dimethylhexan-3-one is CC(C)C(=O)C(Cl)C(C)C.
What is the InChIKey of 4-chloro-2,5-dimethylhexan-3-one?
The InChIKey is FPCHVATUIQGKPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c1-5(2)7(9)8(10)6(3)4/h5-7H,1-4H3.
What are the key properties of 4-chloro-2,5-dimethylhexan-3-one?
4-chloro-2,5-dimethylhexan-3-one has a molecular weight of 162.66 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,5-dimethylhexan-3-one is sourced from PubChem (CID 71435660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).